| Identification | |
| Name: | Triethoxysilane |
| Synonyms: | - |
| CAS: | 998-30-1 |
| EINECS: | 213-650-7 |
| Molecular Formula: | C6H16O3Si |
| Molecular Weight: | 164.28 |
| InChI: | InChI=1/C6H16O3Si/c1-4-7-10(8-5-2)9-6-3/h10H,4-6H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 |
| Flash Point: | 80? |
| Density: | 0.89 |
| Stability: | Stable, but moisture sensitive. Flammable. Incompatible with strong oxidizing agents, strong acids, strong bases. |
| Refractive index: | 1.377 |
| Solubility: |
|
| Appearance: | COLOURLESS LIQUID |
| Packinggroup: | II |
| Flash Point: | 80? |
| Sensitive: | Moisture Sensitive |
| Usage: | Is of commercial importance in the silane and silicone industry for the production of organofunctional coupling agents, low-temperature-vulcanizing (ltv) silicone rubbers and elastomers, and specialty monomers. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
C:Corrosive
|
 |
|
