| Identification | |
| Name: | Butanoic acid,4-hydroxy-, ethyl ester |
| Synonyms: | Butyricacid, 4-hydroxy-, ethyl ester (6CI,7CI,8CI);Ethyl 4-hydroxybutanoate;Ethyl4-hydroxybutyrate;Ethyl g-hydroxybutyrate;NSC 617295; |
| CAS: | 999-10-0 |
| Molecular Formula: | C6H12O3 |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C6H12O3/c1-2-5(3-4-7)6(8)9/h5,7H,2-4H2,1H3,(H,8,9)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 81 ºC |
| Boiling Point: | 205 ºC |
| Density: | 1.027 |
| Specification: |
The Ethyl 4-hydroxybutanoate, with the CAS registry number 999-10-0, is also called Butanoic acid, 4-hydroxy, ethyl ester. And the molecular formula of the chemical is C6H12O3. The characteristics of this chemical are as followings: (1)ACD/LogP: 0.43; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 3; (4)#H bond donors: 1; (5)#Freely Rotating Bonds: 6; (6)Polar Surface Area: 35.53 Å2; (7)Index of Refraction: 1.429; (8)Molar Refractivity: 33.15 cm3; (9)Molar Volume: 128.5 cm3; (10)Polarizability: 13.14×10-24cm3; (11)Surface Tension: 34.8 dyne/cm; (12)Density: 1.027 g/cm3; (13)Flash Point: 81.4 °C; (14)Enthalpy of Vaporization: 51.3 kJ/mol; (15)Boiling Point: 204.8 °C at 760 mmHg; (16)Vapour Pressure: 0.0619 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 81 ºC |
| Safety Data | |
 |
|
