| Identification |
| Name: | Allyl acrylate |
| Synonyms: | Allyl acrylate, (Acrylic acid allyl ester); Acrylic acid allyl ester |
| CAS: | 999-55-3 |
| EINECS: | 213-662-2 |
| Molecular Formula: | C6H8O2 |
| Molecular Weight: | 112.12 |
| InChI: | InChI=1/C6H8O2/c1-3-5-8-6(7)4-2/h3-4H,1-2,5H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 2929 |
| Density: | 0.935 |
| Stability: | Prone to polymerization. Flammable. Incompatible with strong oxidizing agents, acids, bases. |
| Refractive index: | 1.4360 |
| Water Solubility: | slight Stability Prone to polymerization. Flammable. Incompatible with strongoxidizing agents, acids, bases. Toxicology May be harmful - toxicology not fully investigated. Toxici |
| Solubility: | slight |
| Appearance: | colourless liquid |
| Packinggroup: | II |
| Safety Data |
| |
 |
