Identification |
Name: | ethenyl acetate - ethenyl dodecanoate (1:1) |
Synonyms: | ethenyl acetate- ethenyl dodecanoate(1:1);AC1Q5X9V;AC1L521I;Dodecanoic acid, ethenyl ester, polymer with ethenyl acetate;ethenyl acetate; ethenyl dodecanoate;AR-1I7790;Dispersion-copolymers from vinylacetate and vinyllaurate;26354-30-3;66565-72-8 |
CAS: | 26354-30-3;66565-72-8;71281-96-4 |
Molecular Formula: | C18H32O4 |
Molecular Weight: | 312.4443 |
InChI: | InChI=1/C14H26O2.C4H6O2/c1-3-5-6-7-8-9-10-11-12-13-14(15)16-4-2;1-3-6-4(2)5/h4H,2-3,5-13H2,1H3;3H,1H2,2H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 100.8°C |
Boiling Point: | 288.2°C at 760 mmHg |
Flash Point: | 100.8°C |
Safety Data |
|
|