| Identification | |
| Name: | N-(2-aminoethyl)ethane-1,2-diamine; 2-(chloromethyl)oxirane; dimethyl pentanedioate |
| Synonyms: | AC1L59QA;Dimethyl glutarate, diethylenetriamine, epichlorohydrin resin;N'-(2-aminoethyl)ethane-1,2-diamine; 2-(chloromethyl)oxirane; dimethyl pentanedioate;52404-83-8;52847-52-6;68867-69-6;Pentanedioic acid, 1,5-dimethyl ester, polymer with N1-(2-aminoethyl)-1,2-ethanediamine and 2-(chloromethyl)oxirane;Pentanedioic acid, dimethyl ester, polymer with N-(2-aminoethyl)-1,2-ethanediamine and (chloromethyl)oxirane |
| CAS: | 52404-83-8;52847-52-6;68867-69-6 |
| Molecular Formula: | C14H30ClN3O5 |
| Molecular Weight: | 355.8581 |
| InChI: | InChI=1/C7H12O4.C4H13N3.C3H5ClO/c1-10-6(8)4-3-5-7(9)11-2;5-1-3-7-4-2-6;4-1-3-2-5-3/h3-5H2,1-2H3;7H,1-6H2;3H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 103.3°C |
| Boiling Point: | 211.2°C at 760 mmHg |
| Flash Point: | 103.3°C |
| Safety Data | |
 |
|
