| Identification |
| Name: | 2-ethylhexyl prop-2-enoate - butyl prop-2-enoate (1:1) |
| Synonyms: | 2-ethylhexyl prop-2-enoate- butyl prop-2-enoate(1:1);Rikidain AR 825;Acrylic copolymer resin;AC1Q66U5;JSR-AE 610;Acrylic acid, 2-ethylhexyl ester, polymer with butyl acrylate;AC1L5270;AR-1E1618;Butyl acrylate - ethylhexyl acrylate polymer;2-Ethylhexyl acrylate, butyl acrylate polymer;butyl prop-2-enoate; 2-ethylhexyl prop-2-enoate;2-Propenoic acid, butyl ester, polymer with 2-ethylhexyl 2-propenoate;26760-85-0 |
| CAS: | 26760-85-0;58247-84-0 |
| Molecular Formula: | C18H32O4 |
| Molecular Weight: | 312.4443 |
| InChI: | InChI=1/C11H20O2.C7H12O2/c1-4-7-8-10(5-2)9-13-11(12)6-3;1-3-5-6-9-7(8)4-2/h6,10H,3-5,7-9H2,1-2H3;4H,2-3,5-6H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 79.4°C |
| Boiling Point: | 216°C at 760 mmHg |
| Flash Point: | 79.4°C |
| Safety Data |
| |
 |
