Identification |
Name: | 2-methylprop-2-enoic acid - ethyl prop-2-enoate (1:1) |
Synonyms: | Alcogum;Acrysol RM 4;Rhoplex RM 4;Eudragit L 30D;Primal RM 4;Alcogum L 11;Alcogum L 15;Alcogum L 21;RM 4 (polymer);Eudragit L 30D55;Eudragit L 100-55;Eudragit L 100-155;CCRIS 3051;GBC 2620AC;RM 4;Ethyl acrylate-methacrylic acid polymer;DR 1071;Ethyl acrylate, methacrylic acid polymer;Methacrylic acid, ethyl acrylate polymer;Ethyl acrylate, methacrylic acid copolymer;2-Propenoic acid, 2-methyl-, polymer with ethyl 2-propenoate;AK 214-82;Ethyl acrylate, polymer with methacrylic acid;Methacrylic acid, polymer with ethyl acrylate;Ethyl 2-propenoate, 2-methyl-2-propenoic acid copolymer;25212-88-8;Sipacril 2739OF;UNII-NX76LV5T8J;AC1L32IJ;Methacrylic acid ethyl acrylate polymer;LS-89926;ethyl prop-2-enoate; 2-methylprop-2-enoic acid;Ethyl 2-propenoate, 2-methyl-2-propenoic acid polymer;Methacrylic acid - methyl methacrylate copolymer (1:1 mw 135000);100218-76-6;163546-10-9;286390-43-0;52932-72-6;83137-85-3;87659-25-4 |
CAS: | 100218-76-6;163546-10-9;25212-88-8;52932-72-6;83137-85-3;87659-25-4;95032-39-6 |
Molecular Formula: | C9H14O4 |
Molecular Weight: | 186.2051 |
InChI: | InChI=1/C5H8O2.C4H6O2/c1-3-5(6)7-4-2;1-3(2)4(5)6/h3H,1,4H2,2H3;1H2,2H3,(H,5,6) |
Molecular Structure: |
 |
Properties |
Flash Point: | 15.6°C |
Boiling Point: | 99.5°C at 760 mmHg |
Flash Point: | 15.6°C |
Safety Data |
|
 |