| Identification | |
| Name: | Dipropylene glycol |
| Synonyms: | Dipropylene glycol, mixture of isomeric propylene glycol ethers;Dipropylene Glycol (30%);Dipropylene Glycol(77.00%);67% dipropylene glycol;22% Dipropylene Glycol;40% -60% Dipropylene Glycol;1,1'-oxydipropan-1-ol;(2R,2'S)-1,1'-oxydipropan-2-ol;(2R,2'R)-1,1'-oxydipropan-2-ol;(2S,2'S)-1,1'-oxydipropan-2-ol;;1,1'-Oxydi-2-propanol;Diisopropylene glycol;1,1'-oxydipropan-2-ol;2,2'-oxydipropane-1,3-diol |
| CAS: | 25265-71-8;110-98-5 |
| EINECS: | 246-770-3;203-821-4 |
| Molecular Formula: | C6H14O3 |
| Molecular Weight: | 134.1736 |
| InChI: | InChI=1/C6H14O3/c1-5(7)3-9-4-6(2)8/h5-8H,3-4H2,1-2H3/t5-,6-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Density: | 1.034g/cm3 |
| Refractive index: | 1.445 |
| Water Solubility: | MISCIBLE |
| Solubility: | miscible with water |
| Appearance: | colourless liquid |
| Safety Data | |
 |
|
