| Identification |
| Name: | 2-oxo-1,2-diphenylethyl acetate |
| Synonyms: | Acetic acid 2-oxo-1,2-diphenyl-ethyl ester;Ethanone, 2- (acetyloxy)-1,2-diphenyl-;ethanone, 2-(acetyloxy)-1,2-diphenyl- |
| CAS: | 574-06-1;62398-10-1 |
| Molecular Formula: | C16H14O3 |
| Molecular Weight: | 254.2806 |
| InChI: | InChI=1/C16H14O3/c1-12(17)19-16(14-10-6-3-7-11-14)15(18)13-8-4-2-5-9-13/h2-11,16H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 81-82 °C(lit.) |
| Flash Point: | 167.2°C |
| Boiling Point: | 379.3°C at 760 mmHg |
| Density: | 1.161g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.569 |
| Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology Not hazardous according to Directive EC/548/EEC. Toxicity data (The meaning of any toxic |
| Appearance: | solid |
| Flash Point: | 167.2°C |
| Safety Data |
| |
 |
