| Identification | |
| Name: | butane-2,3-diol |
| Synonyms: | 2,3-Butanediol; 2,3-Dihydroxybutane; 2,3-Butanediol, mixture of DL and meso; 2,3-butylene glycol; |
| CAS: | 513-85-9;123513-85-9 |
| EINECS: | 208-173-6 |
| Molecular Formula: | C4H10O2 |
| Molecular Weight: | 90.12 |
| InChI: | InChI=1/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.995 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, acid anhydrides, acid chlorides, chloroformates, reducing agents. |
| Refractive index: | 1.434 |
| Water Solubility: | SOLUBLE |
| Solubility: | Easily soluble in low molecular mass alcohols and ketones. Soluble in alcohol and ether. Moderately sol in diisopropyl ether. In water, miscible at 20 deg C |
| Appearance: | viscous colourless liquid, or colourless to white solid |
| HS Code: | 29053980 |
| Color: | Nearly colorless, crystalline solid or liquid. |
| Safety Data | |
 |
|
