| Identification | |
| Name: | N,N-dimethylpropane-1,3-diamine - 2-methylprop-1-ene (1:1) |
| Synonyms: | AC1L4NG1;1,3-Propanediamine, N,N-dimethyl-, reaction product with chlorinated polyisobutylene;N',N'-dimethylpropane-1,3-diamine; 2-methylprop-1-ene;1,3-Propanediamine, N,N-diethyl-, reaction product with chlorinated polyisobutylene;1,3-Propanediamine, N,N-dimethyl-, reaction products with chlorinated polyisobutylene;1,3-Propanediamine, N1,N1-dimethyl-, reaction products with chlorinated polyisobutylene;68649-56-9 |
| CAS: | 68649-56-9;98761-78-5 |
| Molecular Formula: | C9H22N2 |
| Molecular Weight: | 158.2844 |
| InChI: | InChI=1/C5H14N2.C4H8/c1-7(2)5-3-4-6;1-4(2)3/h3-6H2,1-2H3;1H2,2-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 15.6°C |
| Boiling Point: | 129.5°C at 760 mmHg |
| Flash Point: | 15.6°C |
| Safety Data | |
 |
|
