Identification |
Name: | 3,4-Dimethoxycinnamic acid |
Synonyms: | (2E)-3-(3,4-dimethoxyphenyl)prop-2-enoic acid; Caffeic acid dimethyl ether; 3,4-Dimethoxycinnamonitrile, mixture of cis and trans |
CAS: | 2316-26-9;6443-72-7 |
EINECS: | 219-025-5;229-240-6 |
Molecular Formula: | C11H12O4 |
Molecular Weight: | 208.21 |
InChI: | InChI=1/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/p-1/b6-4+ |
Molecular Structure: |
|
Properties |
Flash Point: | 144°C |
Boiling Point: | 367.4°C at 760 mmHg |
Density: | 1.101 g/cm3 |
Appearance: | Clear yellow liquid |
Flash Point: | 144°C |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|