Identification |
Name: | VE |
CAS: | 59-02-9;121854-78-2;18920-62-2;364-49-8;364-50-1;16826-11-2 |
EINECS: | 218-197-9 |
Molecular Formula: | C29H50O2 |
Molecular Weight: | 430.7061 |
InChI: | InChI=1/C29H50O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22,30H,9-19H2,1-8H3/t21-,22-,29-/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 210.2°C |
Boiling Point: | 485.9°C at 760 mmHg |
Density: | 0.93g/cm3 |
Stability: | Stable. Combustible. May be sensitive to light and air. Incompatible with strong oxidizing agents. |
Refractive index: | 1.495 |
Alpha: | 24 º (c=2, in isooctane 25 ºC) |
Water Solubility: | INSOLUBLE |
Appearance: | light yellow liquid |
Flash Point: | 210.2°C |
Storage Temperature: | 2-8°C |
Safety Data |
|
|