| Identification | |
| Name: | 4-Nitroanisole |
| Synonyms: | 4-Methoxynitrobenzene |
| CAS: | 100-17-4 |
| EINECS: | 202-825-3 |
| Molecular Formula: | C7H7NO3 |
| Molecular Weight: | 153.13 |
| InChI: | InChI=1/C7H7NO3/c1-11-7-4-2-6(3-5-7)8(9)10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3458 |
| Density: | 1.233 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases. |
| Refractive index: | 1.5070 (60 C) |
| Solubility: | 0.468 g/L (20 oC) |
| Appearance: | beige crystalline solid |
| Specification: | beige crystalline solid Safety Statements:61-36/37 61:Avoid release to the environment. Refer to special instructions safety data sheet 36/37:Wear suitable protective clothing and gloves |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Used to make other chemicals. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
