| Identification | |
| Name: | 3-nitroanisole |
| Synonyms: | Nitroanisole; 99%; 3-Methoxynitrobenzene; 3-Nitrophenyl methyl ether; 1-methoxy-3-nitro-benzen; 3-Nitrophenylmethylether; Anisole, m-nitro-; Methyl m-nitrophenyl ether; m-Methoxynitrobenzene; 1-Methoxy-3-nitrobenzene |
| CAS: | 555-03-3 |
| EINECS: | 209-079-8 |
| Molecular Formula: | C7H7NO3 |
| Molecular Weight: | 153.13538 |
| InChI: | InChI=1S/C7H7NO3/c1-11-7-4-2-3-6(5-7)8(9)10/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3458 |
| Density: | 258 |
| Refractive index: | 1.542 |
| Water Solubility: | Stability Stable. Incompatible with strong bases, strong oxidizing agents. Toxicology Harmful if swallowed. Toxicity data (The meaning of any toxicological abbre |
| Solubility: |
|
| Appearance: | yellow solid |
| Specification: | Yellow low melting solid Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Packinggroup: | III |
| HS Code: | 29093090 |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
