| Identification | |
| Name: | 2,5-Dimethyltetrahydrofuran, mixture of cis and trans |
| Synonyms: | 2,5-Dimethyltetrahydrofuran; tetrahydro-2,5-dimethylfuran |
| CAS: | 1003-38-9 |
| EINECS: | 213-707-6 |
| Molecular Formula: | C6H12O |
| Molecular Weight: | 100.16 |
| InChI: | InChI=1/C6H12O/c1-5-3-4-6(2)7-5/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 3 |
| Density: | 0.83 |
| Refractive index: | n20/D 1.404(lit.) |
| Appearance: | clear colorless liquid |
| Packinggroup: | III |
| Storage Temperature: | Refrigerator |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
