| Identification |
| Name: | 2,5-Dimethoxytetrahydrofuran, mixture of cis- and trans isomers |
| Synonyms: | Tetrahydro-2,5-dimethoxyfuran; 2,5-Dimethoxytetrahydrofuran |
| CAS: | 696-59-3 |
| EINECS: | 211-797-1 |
| Molecular Formula: | C6H12O3 |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C6H12O3/c1-7-5-3-4-6(8-2)9-5/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 1993 |
| Density: | 1.021 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.416-1.419 |
| Solubility: | 350 g/L (20 oC) |
| Appearance: | Colorless liquid. |
| Packinggroup: | III |
| HS Code: | 29321900 |
| Storage Temperature: | Flammables area |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
