| Identification |
| Name: | 4,4'-diaminodicyclohexylmethane, mixture of isomers |
| Synonyms: | 4,4-Diaminodicyclohexylmethane; 4,4-Methylenebis(cyclohexylamine); Bis(4-aminocyclohexyl)methane; 4,4'-diaminodicyclohexylmethane |
| CAS: | 1761-71-3 |
| EINECS: | 217-168-8 |
| Molecular Formula: | C13H26N2 |
| Molecular Weight: | 210.36 |
| InChI: | InChI=1/C13H26N2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11/h10-13H,1-9,14-15H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2928 |
| Flash Point: | 108.1°C |
| Density: | 0.96 |
| Stability: | No data. |
| Refractive index: | 1.499 |
| Water Solubility: | Insoluble (<0.1 g/100 mL) |
| Solubility: | Insoluble (<0.1 g/100 mL) |
| Appearance: | Yellowish white liquid or brown solid paste. |
| Packinggroup: | III |
| Flash Point: | 108.1°C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
T+:Verytoxic
N:Dangerousfortheenvironment
|
| |
 |
