| Identification | |
| Name: | Pyridine, 4-methyl-,1-oxide |
| Synonyms: | 4-Picoline,1-oxide (6CI,8CI);4-Methylpyridine 1-oxide;4-Methylpyridine N-oxide;4-Methylpyridine oxide;4-Picoline N-oxide;4-Picoline oxide;NSC 5086;g-Picoline 1-oxide;g-Picoline N-oxide;g-Picoline oxide;N-oxide of 4-methyl pyridine; |
| CAS: | 1003-67-4 |
| EINECS: | 213-712-3 |
| Molecular Formula: | C6H7NO |
| Molecular Weight: | 109.13 |
| InChI: | InChI=1/C6H7NO/c1-6-2-4-7(8)5-3-6/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.01 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.512 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | Brown crystalline powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29333999 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Hygroscopic |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
