Identification |
Name: | Pyridine, 3-methyl-,1-oxide |
Synonyms: | 3-Picoline,1-oxide (6CI,8CI);3-Methylpyridine 1-oxide;3-Methylpyridine N-oxide;3-Picoline N-oxide;NSC 18254;b-Picoline 1-oxide;b-Picoline N-oxide;b-Picoline oxide;N-oxide of 3-methyl pyridine; |
CAS: | 1003-73-2 |
EINECS: | 213-714-4 |
Molecular Formula: | C6H7NO |
Molecular Weight: | 109.13 |
InChI: | InChI=1/C6H7NO/c1-6-3-2-4-7(8)5-6/h2-5H,1H3 |
Molecular Structure: |
 |
Properties |
Density: | 1.01g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.5839 (45 C) |
Water Solubility: | soluble |
Solubility: | soluble |
Appearance: | Brown solid. |
Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Sensitive: | Hygroscopic |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |