| Identification | |
| Name: | Hexanoic acid,(2E)-3,7-dimethyl-2,6-octadien-1-yl ester |
| Synonyms: | Hexanoicacid, (2E)-3,7-dimethyl-2,6-octadienyl ester (9CI); Hexanoic acid,3,7-dimethyl-2,6-octadienyl ester, (E)- (8CI); 2,6-Octadien-1-ol,3,7-dimethyl-, hexanoate, (E)- (8CI); Geraniol caproate; Geraniol hexanoate;Geranyl caproate; Geranyl hexanoate |
| CAS: | 10032-02-7 |
| EINECS: | 233-102-0 |
| Molecular Formula: | C16H28 O2 |
| Molecular Weight: | 252.44 |
| InChI: | InChI=1/C16H28O2/c1-5-6-7-11-16(17)18-13-12-15(4)10-8-9-14(2)3/h9,12H,5-8,10-11,13H2,1-4H3/b15-12+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 101.3 ºC |
| Boiling Point: | 333.3ºC at 760 mmHg |
| Density: | 0.891 g/cm3 |
| Refractive index: | 1.461 |
| Specification: |
[(2E)-3,7-Dimethylocta-2,6-dienyl] hexanoate with CAS number of 10032-02-7 is also named as (2E)-3,7-Dimethyl-2,6-octadienyl hexanoate ; (E)-3,7-Dimethylocta-2,6-dien-1-yl n-hexanoate ; (e)-3,7-Dimethylocta-2,6-dien-1-yln-hexanoate ; 2,6-Octadien-1-ol, 3,7-dimethyl-, hexanoate, (E)- ; 3,7-Dimethyl-,hexanoate,(e)-6-octadien-1-ol ; 3,7-Dimethyl-2,6-octadienylester,(e)-hexanoicaci ; 3,7-Dimethylocta-2,6-dien-1-ylester,(e)-hexanoicaci ; Geranyl hexanoate . Natural products present in the kumquat skin oil, passion fruit (purple), and papaya in. It can be used for food spices. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 101.3 ºC |
| Safety Data | |
 |
|
