| Identification | |
| Name: | Butanoic acid,(2E)-3,7-dimethyl-2,6-octadien-1-yl ester |
| Synonyms: | Butanoicacid, (2E)-3,7-dimethyl-2,6-octadienyl ester (9CI);Butanoic acid,3,7-dimethyl-2,6-octadienyl ester, (E)-;Butyric acid,3,7-dimethyl-2,6-octadienyl ester, (E)- (8CI);Butyric acid, geranyl ester(6CI);2,6-Octadien-1-ol, 3,7-dimethyl-, butyrate, (E)- (8CI);AG 76;Geraniolbutyrate;Geranyl butanoate;Geranyl n-butyrate;NSC 46146;NSC 70177;trans-3,7-Dimethyl-2,6-octadien-1-yl butyrate; |
| CAS: | 106-29-6 |
| EINECS: | 203-381-3 |
| Molecular Formula: | C14H24O2 |
| Molecular Weight: | 224.34 |
| InChI: | InChI=1/C14H24O2/c1-5-7-14(15)16-11-10-13(4)9-6-8-12(2)3/h8,10H,5-7,9,11H2,1-4H3/b13-10+ |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.896 |
| Refractive index: | 1.461 |
| Water Solubility: | soluble in alcohol, most fixed oils; insoluble in glycerol, propylene glycol, water |
| Solubility: | soluble in alcohol, most fixed oils; insoluble in glycerol, propylene glycol, water |
| Appearance: | colourless to pale yellow liquid/fruity, rose-like odour |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
