| Identification | |
| Name: | 1-Butanone,1-(4-hydroxyphenyl)- |
| Synonyms: | Butyrophenone,4'-hydroxy- (6CI,7CI,8CI);1-(4-Hydroxyphenyl)butan-1-one;4-Butanoylphenol;4-Butyrylphenol;4'-Hydroxybutyrophenone;NSC 17548;p-Butyrylphenol;p-Hydroxybutyrophenone; |
| CAS: | 1009-11-6 |
| EINECS: | 213-766-8 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-2-3-10(12)8-4-6-9(11)7-5-8/h4-7,11H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Density: | 1.077 g/cm3 |
| Refractive index: | 1.534 |
| Appearance: | white crystal |
| Specification: |
1-Butanone,1-(4-hydroxyphenyl)- , its cas register number is 1009-11-6. It also can be called 4-Butyrylphenol ; 4-Hydroxybutyrophenone ; p-Butyrylphenol ; p-Hydroxybutyrophenone ; 4'-Hydroxybutyrophenone ; and p-Hydroxyphenyl propyl ketone . |
| Safety Data | |
| Hazard Symbols | |
 |
|
