| Identification | |
| Name: | 1-Butanone,1-(2-hydroxyphenyl)- |
| Synonyms: | Butyrophenone,2'-hydroxy- (6CI,7CI,8CI); 2-Butyrylphenol; 2-Hydroxybutyrophenone;2'-Hydroxybutyrophenone; Propyl 2-hydroxyphenyl ketone; o-Hydroxybutyrophenone |
| CAS: | 2887-61-8 |
| EINECS: | 220-749-9 |
| Molecular Formula: | C10H12 O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-2-5-9(11)8-6-3-4-7-10(8)12/h3-4,6-7,12H,2,5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.077 g/cm3 |
| Refractive index: | 1.534 |
| Appearance: | Colorless to pale yellow |
| Specification: |
1-Butanone,1-(2-hydroxyphenyl)- , its cas register number is 2887-61-8. It also can be called 2'-Hydroxybutyrophenone ; Butyrophenone, 2'-hydroxy- ; and 1-(2-Hydroxyphenyl)butan-1-one . |
| Safety Data | |
 |
|
