| Identification |
| Name: | Benzenepropanoic acid, a-methyl- |
| CAS: | 1009-67-2 |
| EINECS: | 201-982-5 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2011 |
| InChI: | InChI=1/C10H12O2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,11,12)/p-1/t8-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 113 ºC |
| Stability: | Stable at normal temperatures and pressures. |
| Solubility: | 0.74 g/L (25 C) |
| Appearance: | white to light yellow crystalline powder |
| Flash Point: | 113 ºC |
| Storage Temperature: | Keep tightly closed. Store in a cool dry place. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
