| Identification | |
| Name: | 2-Butenedioic acid(2Z)-, mono[2-(2-hydroxyethoxy)ethyl] ester (9CI) |
| Synonyms: | 2-Butenedioicacid (Z)-, mono[2-(2-hydroxyethoxy)ethyl] ester; Maleic acid,mono[2-(2-hydroxyethoxy)ethyl] ester (8CI); Diethylene glycol, mono(hydrogenmaleate) (8CI); Diethylene glycol monomaleate; Hydrogen2-(2-hydroxyethoxy)ethyl maleate; Hydroxyethoxyethyl hydrogen maleate;Mono[2-(2-hydroxyethoxy)ethyl] maleate |
| CAS: | 10099-72-6 |
| Molecular Formula: | C8H12 O6 |
| Molecular Weight: | 204.20 |
| InChI: | InChI=1/C8H12O6/c9-3-4-13-5-6-14-8(12)2-1-7(10)11/h1-2,9H,3-6H2,(H,10,11)/b2-1- |
| Molecular Structure: | ![(C8H12O6) 2-Butenedioicacid (Z)-, mono[2-(2-hydroxyethoxy)ethyl] ester; Maleic acid,mono[2-(2-hydroxyethoxy)et...](https://img1.guidechem.com/chem/e/dict/38/10099-72-6.jpg) |
| Properties | |
| Flash Point: | 165.3°C |
| Boiling Point: | 407.3°Cat760mmHg |
| Density: | 1.307g/cm3 |
| Refractive index: | 1.498 |
| Report: |
Maleic acid, mono(hydroxyethoxy-ethyl) ester (CAS NO.10099-72-6) was reported in AMIHBC AMA Archives of Industrial Hygiene and Occupational Medicine. |
| Flash Point: | 165.3°C |
| Safety Data | |
 |
|
