| Identification | |
| Name: | Phenol,4-(phenylmethyl)- |
| Synonyms: | p-Cresol, a-phenyl- (6CI,8CI);1-Hydroxy-4-(phenylmethyl)benzene;4-(Phenylmethyl)phenol;4-Benzylphenol;4-Hydroxydiphenylmethane;4-Hydroxyditane;AI 3-1932;Fesiasept;NSC 8078;p-Benzylphenol;p-Hydroxydiphenyl methane;a-Phenyl-p-cresol; |
| CAS: | 101-53-1 |
| EINECS: | 202-950-3 |
| Molecular Formula: | C13H12O |
| Molecular Weight: | 184.23 |
| InChI: | InChI=1/C13H12O/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9,14H,10H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.101g/cm3 |
| Refractive index: | 1.602 |
| Appearance: | white solid |
| Specification: | White Solid Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
