Identification |
Name: | Phenol,4-(phenylmethyl)- |
Synonyms: | p-Cresol, a-phenyl- (6CI,8CI);1-Hydroxy-4-(phenylmethyl)benzene;4-(Phenylmethyl)phenol;4-Benzylphenol;4-Hydroxydiphenylmethane;4-Hydroxyditane;AI 3-1932;Fesiasept;NSC 8078;p-Benzylphenol;p-Hydroxydiphenyl methane;a-Phenyl-p-cresol; |
CAS: | 101-53-1 |
EINECS: | 202-950-3 |
Molecular Formula: | C13H12O |
Molecular Weight: | 184.23 |
InChI: | InChI=1/C13H12O/c14-13-8-6-12(7-9-13)10-11-4-2-1-3-5-11/h1-9,14H,10H2 |
Molecular Structure: |
 |
Properties |
Density: | 1.101g/cm3 |
Refractive index: | 1.602 |
Appearance: | white solid |
Specification: | White Solid Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |