| Identification | |
| Name: | Diglycidyl resorcinol ether |
| Synonyms: | Benzene,m-bis(2,3-epoxypropoxy)- (6CI,7CI,8CI); 1,3-Bis(2,3-epoxypropoxy)benzene;1,3-Diglycidyloxybenzene; Diglycidyl resorcinol ether; NSC 76621; Resorcinolbis(2,3-epoxypropyl) ether; Resorcinol diglycidyl ether; Resorcinol glycidylether; m-Bis(2,3-epoxypropoxy)benzene; m-Bis(glycidyloxy)benzene |
| CAS: | 101-90-6 |
| EINECS: | 202-987-5 |
| Molecular Formula: | C12H14 O4 |
| Molecular Weight: | 222.2372 |
| InChI: | InChI=1S/C12H14O4/c1-2-9(13-5-11-7-15-11)4-10(3-1)14-6-12-8-16-12/h1-4,11-12H,5-8H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.21 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.542 |
| Water Solubility: | H2O: insoluble |
| Solubility: | H2O: insoluble |
| Appearance: | yellow liquid |
| Specification: | yellow liquid Safety Statements:23-36/37-61 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 36/37:Wear suitable protective clothing and gloves 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Packinggroup: | II |
| Storage Temperature: | Storage location should be close to laboratory where it is to be used, so that only small amounts need to be transported. Carcinogens should be kept in only one section of storage area, explosion-proof refrigerator or freezer as required. The area should be appropriately labeled. An inventory should be kept showing the quantity of carcinogen and date it was acquired. Facilities for dispensing should be contiguous to storage area. |
| Color: | STRAW-YELLOW LIQUID |
| Usage: | Epoxy resins. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
