| Identification |
| Name: | Neopentyl glycol diglycidyl ether |
| Synonyms: | Propane,1,3-bis(2,3-epoxypropoxy)-2,2-dimethyl- (8CI);1,3-Bis(2,3-epoxypropoxy)-2,2-dimethylpropane;1,3-Bis(glycidyloxy)-2,2-dimethylpropane;2,2-Bis(glycidyloxymethyl)propane;2,2'-[(2,2-Dimethyl-1,3-propanediyl)bis(oxymethylene)]bis[oxirane];Oxirane,2,2'-[(2,2-dimethyl-1,3-propanediyl)bis(oxymethylene)]bis-; |
| CAS: | 17557-23-2 |
| EINECS: | 241-536-7 |
| Molecular Formula: | C11H20O4 |
| Molecular Weight: | 216.31 |
| InChI: | InChI=1/C6H10O3.C5H12O2/c1(5-3-8-5)7-2-6-4-9-6;1-5(2,3-6)4-7/h5-6H,1-4H2;6-7H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 76 |
| Flash Point: | >110 oC |
| Boiling Point: | 103-107 oC (1 mmHg) |
| Density: | 1.04 |
| Stability: | Stable. Incompatible with strong oxidizing agents, sulfuric acid, dichromates. Combustible. |
| Refractive index: | 1.457 |
| Water Solubility: | 0.5-1.0 G/100 ML AT 20.5 oC |
| Solubility: | 0.5-1.0 g/100 mL at 20.5 oC in water |
| Appearance: | Colorless transparent liquid |
| Flash Point: | >110 oC |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
