| Identification | |
| Name: | Phenoxazin-5-ium,1,3-diamino-7-(diethylamino)-8-methyl-, chloride (1:1) |
| Synonyms: | Phenoxazin-5-ium,1,3-diamino-7-(diethylamino)-8-methyl-, chloride (8CI,9CI); 1,3-Diamino-7-(diethylamino)-8-methylphenoxazin-5-iumchloride; Brilliant Cresyl Blue; Brilliant Cresyl Blue BB; C.I. 51010 |
| CAS: | 10127-36-3 |
| EINECS: | 233-358-3 |
| Molecular Formula: | C17H21 N4 O . Cl |
| Molecular Weight: | 332.87 |
| InChI: | InChI=1/C17H20N4O/c1-4-21(5-2)14-9-15-13(6-10(14)3)20-17-12(19)7-11(18)8-16(17)22-15/h6-9,19H,4-5,18H2,1-3H3/b19-12+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Refractive index: | 1.646 |
| Specification: |
The extinguishing agent of Brilliant cresyl blue (CAS NO.10127-36-3) are dry powder, foam, sand, carbon dioxide, water mist. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | °C |
| Safety Data | |
 |
|
