| Identification | |
| Name: | Benzeneacetic acid,3,4-dihydroxy- |
| Synonyms: | Aceticacid, (3,4-dihydroxyphenyl)- (8CI);(3,4-Dihydroxyphenyl)acetic acid;3,4-Dihydroxybenzeneacetic acid;Ba 2773;DOPAC;Dihydroxyphenylacetic acid;Dopacetic acid;Homoprotocatechuic acid;NSC 73191; |
| CAS: | 102-32-9 |
| EINECS: | 203-024-1 |
| Molecular Formula: | C8H8O4 |
| Molecular Weight: | 168.15 |
| InChI: | InChI=1/C8H8O4/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3,9-10H,4H2,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 221°C |
| Boiling Point: | 418.4°Cat760mmHg |
| Density: | 1.478g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.628 |
| Solubility: | Very soluble |
| Appearance: | Beige powder. |
| Specification: | beige to light brown crystalline powder Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 221°C |
| Storage Temperature: | −20°C |
| Usage: | An important metabolite when studying the behaviour of the dopaminergic system. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
