| Identification | |
| Name: | Benzeneacetic acid,2,5-dihydroxy- |
| Synonyms: | Aceticacid, (2,5-dihydroxyphenyl)- (8CI); 2,5-Dihydroxy-a-toluic acid; 2,5-Dihydroxyphenylacetic acid;Alcapton; Homogentisic acid; Homogentisinic acid; NSC 88940 |
| CAS: | 451-13-8 |
| EINECS: | 207-192-7 |
| Molecular Formula: | C8H8 O4 |
| Molecular Weight: | 168.15 |
| InChI: | InChI=1/C8H8O4/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 150-152 °C(lit.) |
| Flash Point: | 233.6°C |
| Boiling Point: | 439.3°Cat760mmHg |
| Density: | 1.478g/cm3 |
| Specification: | off-white to tan crystals or crystalline powder usageEng:An intermediate in the metabolism of tyrosine and phenylalanine. Occurs in plants and in the urine of alkaptonurics. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 233.6°C |
| Storage Temperature: | 2-8°C |
| Color: | off-white to tan |
| Usage: | An intermediate in the metabolism of tyrosine and phenylalanine. Occurs in plants and in the urine of alkaptonurics. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
