| Identification | |
| Name: | 2,5-Dimethoxyaniline |
| Synonyms: | Dimethoxyaniline,97%; Dimethoxyaniline,95%; Aminohydroquinone dimethyl ether |
| CAS: | 102-56-7 |
| EINECS: | 203-040-9 |
| Molecular Formula: | C8H11NO2 |
| Molecular Weight: | 153.18 |
| InChI: | InChI=1/C8H11NO2/c1-10-6-3-4-8(11-2)7(9)5-6/h3-5H,9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1407 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.54 |
| Solubility: | Soluble AUTOIGNITION |
| Appearance: | off-white to gray powder |
| Specification: | grey to dark brown crystalline powder or lumps Safety Statements:45-36/37/39-26-22 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 22:Do not breathe dust |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
