| Identification | |
| Name: | 2,4-Dimethoxyaniline |
| Synonyms: | 4-Aminoresorcinol dimethyl ether |
| CAS: | 2735-04-8 |
| EINECS: | 220-355-7 |
| Molecular Formula: | C8H11NO2 |
| Molecular Weight: | 153.18 |
| InChI: | InChI=1/C8H11NO2/c1-10-6-3-4-7(9)8(5-6)11-2/h3-5H,9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Flash Point: | 124.8°C |
| Boiling Point: | 267.1°Cat760mmHg |
| Density: | 1.075 |
| Stability: | Stability Stable, but sensitive to prolonged exposure to light. Incompatible with acids. |
| Refractive index: | 1.6 |
| Solubility: | 7 g/L (20 ºC) |
| Appearance: | Dark brown solid. |
| Specification: |
2,4-Dimethoxyaniline (2735-04-8) is a black crystalline solid and mainly used as an organic synthesis intermediate for the production of dyes. 2,4-Dimethoxyaniline (2735-04-8) is stable and should store in tightly sealed containers in a cool place. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 124.8°C |
| Storage Temperature: | Refrigerator |
| Color: | PLATES FROM PETROLEUM ETHER |
| Usage: | Chemical intermediate for c.I. Basic yellow 11. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
