| Identification | |
| Name: | Phosphorous acid,tri-2-propen-1-yl ester |
| Synonyms: | Allylphosphite (6CI,7CI); Phosphorous acid, tri-2-propenyl ester (9CI); Phosphorousacid, triallyl ester (8CI); NSC 44606; Triallyl phosphite; Triallyloxyphosphine |
| CAS: | 102-84-1 |
| EINECS: | 203-060-8 |
| Molecular Formula: | C9H15O3P |
| Molecular Weight: | 202.19 |
| InChI: | InChI=1/C9H15O3P/c1-4-7-10-13(11-8-5-2)12-9-6-3/h4-6H,1-3,7-9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN3278 |
| Flash Point: | 86.7 ºC |
| Boiling Point: | 201.4 ºC at 760 mmHg |
| Density: | g/cm3 |
| Specification: | Safety Statements:23-26-36/37/39 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | III |
| Flash Point: | 86.7 ºC |
| Sensitive: | Air & Moisture Sensitive |
| Safety Data | |
| Hazard Symbols | |
 |
|
