| Identification | |
| Name: | Boric acid (H3BO3),tri-2-propen-1-yl ester |
| Synonyms: | Allylborate (6CI,7CI); Boric acid (H3BO3), tri-2-propenyl ester (9CI); Boric acid(H3BO3), triallyl ester (8CI); Allyl borate ((C3H5O)3B); NSC 65653; Triallylborate; Triallyloxyborane; Tris(allyloxy)borane; Trisallyl borate |
| CAS: | 1693-71-6 |
| EINECS: | 216-897-9 |
| Molecular Formula: | C9H15 B O3 |
| Molecular Weight: | 182.0246 |
| InChI: | InChI=1/C9H15BO3/c1-4-7-11-10(12-8-5-2)13-9-6-3/h4-6H,1-3,7-9H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1993 |
| Density: | 0,919 g/cm3 |
| Refractive index: | 1.4270 |
| Specification: |
It behave similarly to esters in that they react with acids to liberate heat along with alcohols and acids. Strong oxidizing acids may cause a vigorous reaction that is sufficiently exothermic to ignite the reaction products. Heat is also generated by the interaction of esters with caustic solutions. Flammable hydrogen is generated by mixing esters/borates with alkali metals and hydrides. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Safety Data | |
 |
|
