Identification |
Name: | Boric acid (H3BO3),tripentyl ester |
Synonyms: | Pentylborate (6CI,7CI); (Tri-n-pentoxy)borane; NSC 780; Triamyl borate; Tripentylborate; Tripentyl borate ((C5H11O)3B) |
CAS: | 621-78-3 |
EINECS: | 210-706-2 |
Molecular Formula: | C15H33 B O3 |
Molecular Weight: | 272.29 |
InChI: | InChI=1/C15H33BO3/c1-4-7-10-13-17-16(18-14-11-8-5-2)19-15-12-9-6-3/h4-15H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Transport: | 2810 |
Melting Point: | 180°C (dec.) |
Flash Point: | 83°C |
Boiling Point: | 63°C 0mm |
Density: | 0.858g/cm3 |
Refractive index: | 1.419 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Report: |
Reported in EPA TSCA Inventory.
|
Packinggroup: | III |
Flash Point: | 83°C |
Safety Data |
|
 |