Identification |
Name: | Boric acid (H3BO3),triisotridecyl ester (9CI) |
Synonyms: | Isotridecanol,triester with boric acid (H3BO3) |
CAS: | 59802-06-1 |
EINECS: | 261-933-9 |
Molecular Formula: | C39H81 B O3 |
Molecular Weight: | 608.86964 |
InChI: | InChI=1/C39H81BO3/c1-37(2)31-25-19-13-7-10-16-22-28-34-41-40(42-35-29-23-17-11-8-14-20-26-32-38(3)4)43-36-30-24-18-12-9-15-21-27-33-39(5)6/h37-39H,7-36H2,1-6H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 195.7°C |
Boiling Point: | 520.2°C at 760 mmHg |
Density: | 0.852g/cm3 |
Refractive index: | 1.448 |
Flash Point: | 195.7°C |
Safety Data |
|
 |