| Identification | |
| Name: | Tri-n-hexylamine |
| Synonyms: | - |
| CAS: | 102-86-3 |
| EINECS: | 203-062-9 |
| Molecular Formula: | C18H39N |
| Molecular Weight: | 269.51 |
| InChI: | InChI=1/C18H39N/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h4-18H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 9 |
| Density: | 0.795 |
| Refractive index: | n20/D 1.442(lit.) |
| Water Solubility: | Slightly soluble in water |
| Solubility: | Slightly soluble in water |
| Appearance: | Colorless to light yellow liquild |
| Specification: |
1-Hexanamine,N,N-dihexyl- , its cas register number is 102-86-3. It also can be called Tri-n-hexylamine ; and N,N-Dihexylhexan-1-amine . |
| Packinggroup: | III |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
