| Identification | |
| Name: | 3,5-Dichlorobenzaldehyde |
| Synonyms: | - |
| CAS: | 10203-08-4 |
| EINECS: | 233-499-0 |
| Molecular Formula: | C7H4Cl2O |
| Molecular Weight: | 175.01 |
| InChI: | InChI=1/C7H4Cl2O/c8-6-1-5(4-10)2-7(9)3-6/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 235 |
| Stability: | No data. |
| Refractive index: | 1.6 |
| Solubility: | Insoluble |
| Appearance: | white to slightly yellow fluffy powder |
| Specification: |
Benzaldehyde, 3,5-dichloro- , its cas register number is 10203-08-4. It also can be called NSC 109095 ; 3,5-Dichlorobenzaldehyde . It is a white to slightly yellow fluffy powder. |
| Packinggroup: | III |
| HS Code: | 29130000 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
Xn:Harmful
|
 |
|
