| Identification | |
| Name: | 2,3-Dichlorobenzaldehyde |
| Synonyms: | 2,3-DICHLORO BENZALDEHYDE; 2,3-DCBA |
| CAS: | 6334-18-5 |
| EINECS: | 228-711-3 |
| Molecular Formula: | C7H4Cl2O |
| Molecular Weight: | 175.01 |
| InChI: | InChI=1/C7H4Cl2O/c8-6-3-1-2-5(4-10)7(6)9/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 |
| Density: | 1.4 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | Insoluble |
| Appearance: | White crystal |
| Specification: |
?2,3-Dichlorobenzaldehyde , its CAS NO. is 6334-18-5, the synonyms are Benzaldehyde, 2,3-dichloro- ; Benzaldehyde, dichloro- ; Benzaldehyde, 2,3-dichloro- . |
| Packinggroup: | III |
| HS Code: | 29130000 |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
