| Identification | |
| Name: | nonanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) |
| Synonyms: | Nonanoic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);Nonanoic acid triethanolamine salt;Nonanoic acid, triethanolamine salt;Pelargonic acid, triethanolamine salt;Nonanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);nonanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
| CAS: | 10246-68-1 |
| EINECS: | 233-581-6 |
| Molecular Formula: | C15H33NO5 |
| Molecular Weight: | 307.4262 |
| InChI: | InChI=1/C9H18O2.C6H15NO3/c1-2-3-4-5-6-7-8-9(10)11;8-4-1-7(2-5-9)3-6-10/h2-8H2,1H3,(H,10,11);8-10H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 114.9°C |
| Boiling Point: | 254.9°C at 760 mmHg |
| Flash Point: | 114.9°C |
| Safety Data | |
 |
|
