Identification |
Name: | 2-ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1) |
Synonyms: | Hexanoic acid, 2-ethyl-, compd. with 2,2',2''-nitrilotris(ethanol) (1:1);2-Ethylhexanoic acid compound with triethanolamine (1:1);Triethanolamine 2-ethylhexoate;2-Ethylhexanoic acid, compound with 2,2',2''-nitrilotriethanol (1:1);2-ethylhexanoic acid - 2,2',2''-nitrilotriethanol (1:1) |
CAS: | 38584-87-1 |
EINECS: | 254-020-1 |
Molecular Formula: | C14H31NO5 |
Molecular Weight: | 293.3996 |
InChI: | InChI=1/C8H16O2.C6H15NO3/c1-3-5-6-7(4-2)8(9)10;8-4-1-7(2-5-9)3-6-10/h7H,3-6H2,1-2H3,(H,9,10);8-10H,1-6H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 116.6°C |
Boiling Point: | 228°C at 760 mmHg |
Flash Point: | 116.6°C |
Safety Data |
|
 |