| Identification |
| Name: | 2-ethylhexanoic acid, compound with 2,2'-iminodiethanol (1:1) |
| Synonyms: | Hexanoic acid, 2-ethyl-, compd. with 2,2'-iminobis(ethanol) (1:1);2-Ethylhexanoic acid diethanolamine salt;2-Ethylhexanoic acid, reaction product with diethanolamine;2-Ethylhexoic acid, diethanolamine salt;2-Ethylhexanoic acid, compound with 2,2'-iminodiethanol (1:1);2-ethylhexanoic acid - 2,2'-iminodiethanol (1:1) |
| CAS: | 68528-01-8 |
| EINECS: | 271-294-8 |
| Molecular Formula: | C12H27NO4 |
| Molecular Weight: | 249.3471 |
| InChI: | InChI=1/C8H16O2.C4H11NO2/c1-3-5-6-7(4-2)8(9)10;6-3-1-5-2-4-7/h7H,3-6H2,1-2H3,(H,9,10);5-7H,1-4H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 116.6°C |
| Boiling Point: | 228°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 116.6°C |
| Safety Data |
| |
 |
