| Identification | |
| Name: | Acetic acid, 2-cyano-,2-methoxyethyl ester |
| Synonyms: | Aceticacid, cyano-, 2-methoxyethyl ester (7CI,8CI,9CI);Ethanol, 2-methoxy-,cyanoacetate (8CI);Cyanoacetic acid,2-methoxyethyl ester;Cyanoacetic acid, b-methoxyethyl ester; |
| CAS: | 10258-54-5 |
| EINECS: | 233-597-3 |
| Molecular Formula: | C6H9NO3 |
| Molecular Weight: | 143.14 |
| InChI: | InChI=1/C6H9NO3/c1-9-4-5-10-6(8)2-3-7/h2,4-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1.127 |
| Refractive index: | 1.434 |
| Appearance: | Clear to very yellow liquid |
| Packinggroup: | III |
| Usage: |
2-Methoxyethyl cyanoacetate (10258-54-5) can be used as intermediate for numerous organic syntheses, e.g. alpha-cyanoacrylic adhesives. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
