| Identification | |
| Name: | 9,10-Ethanoanthracene-9(10H)-propanamine,N-methyl- |
| Synonyms: | 9,10-Ethanoanthracene-9(10H)-propylamine,N-methyl- (7CI,8CI);Maprotiline;N-Methyl-9,10-ethanoanthracene-9(10H)-propylamine; |
| CAS: | 10262-69-8 |
| EINECS: | 233-599-4 |
| Molecular Formula: | C20H23N |
| Molecular Weight: | 277.44 |
| InChI: | InChI=1/C20H23N/c1-21-14-6-12-20-13-11-15(16-7-2-4-9-18(16)20)17-8-3-5-10-19(17)20/h2-5,7-10,15,21H,6,11-14H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Density: | 1.08 g/cm3 |
| Refractive index: | 1.599 |
| Specification: |
Ludiomil (10262-69-8) is a tetracyclic antidepressant (TeCA). It is a strong norepinephrine reuptake inhibitor with only weak effects on serotonin and dopamine reuptake.it causes a strong initial sedation (first 2 to 3 weeks of therapy) and is therefore indicated to treat agitated patients or those with suicidal risks. It causes anticholinergic side effects with a lower incidence than Amitritypline. Originally, the manufacturer claimed that Maprotiline is better tolerated than other tri-/tetrcyclic drugs. This is not the case because seizures, leukopenia and skin reactions occur more often with Maprotiline than with comparable drugs like Amitriptyline. |
| Packinggroup: | III |
| Safety Data | |
 |
|
