| Identification | |
| Name: | (R)-(-)-1-Aminoindan |
| Synonyms: | 1-Indanamine,(R)- (8CI);1H-Inden-1-amine, 2,3-dihydro-, (R)-;(-)-1-Aminoindan;(1R)-2,3-Dihydro-1H-inden-1-amine;(1R)-2,3-Dihydro-1H-inden-1-ylamine;(1R)-2,3-Dihydro-1H-indene-1-amine; |
| CAS: | 10277-74-4 |
| EINECS: | 252-158-7 |
| Molecular Formula: | C9H11N |
| Molecular Weight: | 133.19 |
| InChI: | InChI=1/C9H11N/c10-9-6-5-7-3-1-2-4-8(7)9/h1-4,9H,5-6,10H2/t9-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.038 |
| Refractive index: | 1.56-1.562 |
| Alpha: | -20 º (C=1.5, MEOH) |
| Appearance: | clear colorless to slightly yellow liquid |
| Specification: |
(R)-(-)-1-Aminoindan , its cas register number is 10277-74-4. It also can be called (R)-(-)-Indanamine .It is a clear colorless to slightly yellow liquid. |
| Storage Temperature: | 2-8°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
