Identification |
Name: | Bis(2-ethylhexyl) adipate |
Synonyms: | DIOA |
CAS: | 103-23-1 |
EINECS: | 203-090-1 |
Molecular Formula: | C22H42O4 |
Molecular Weight: | 370.57 |
InChI: | InChI=1/C22H42O4/c1-5-9-13-19(7-3)17-25-21(23)15-11-12-16-22(24)26-18-20(8-4)14-10-6-2/h19-20H,5-18H2,1-4H3 |
Molecular Structure: |
|
Properties |
Transport: | UN 1230 3/PG 2 |
Density: | 0.928 |
Stability: | Stable. Incompatible with oxidizing agents, water, nitrates. |
Refractive index: | 1.446-1.448 |
Water Solubility: | immiscible |
Solubility: | immiscible |
Appearance: | colorless or light yellow oily liquid with special odour |
Specification: | colourless oily liquid Safety Statements:26-36-45-36/37 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) 36/37:Wear suitable protective clothing and gloves |
HS Code: | 29171290 |
Color: | COLORLESS OR VERY PALE AMBER LIQ Light colored, oily liquid. |
Usage: | Plasticizer, commonly blended with general purpose plasticizers, such as di-n-octyl phthalate and diisooctyl phthalate in processing polyvinyl and other polymers, solvent, aircraft lubes. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|