| Identification | |
| Name: | Bis(2-ethylhexyl)amine |
| CAS: | 106-20-7 |
| EINECS: | 203-372-4 |
| Molecular Formula: | C16H35N |
| Molecular Weight: | 241.46 |
| InChI: | InChI=1/C16H35N/c1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2/h15-17H,5-14H2,1-4H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2735 |
| Density: | 0.803 |
| Stability: | Stable. Combustible. Incompatible with oxidizing agents. |
| Refractive index: | 1.4415-1.4435 |
| Water Solubility: | sparingly soluble |
| Solubility: | sparingly soluble |
| Appearance: | Clear liquid |
| Specification: |
2,2'-Diethyldihexylamine (CAS NO.106-20-7) can react with oxidizing materials . Neutralizes acids in exothermic reactions to form salts plus water. May be incompatible with isocyanates, halogenated organics, peroxides, phenols (acidic), epoxides, anhydrides, and acid halides. Flammable gaseous hydrogen may be generated in combination with strong reducing agents, such as hydrides. |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| HS Code: | 29211980 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
