| Identification | |
| Name: | 2-Propenoicacid, 3-phenyl-, phenylmethyl ester |
| Synonyms: | Cinnamicacid, benzyl ester (6CI,7CI,8CI);3-Phenyl-2-propenoic acid benzyl ester;Benzyl 3-phenylpropenoate;Benzyl g-phenylacrylate;Cinnamein;NSC 11780;NSC 44403; |
| CAS: | 103-41-3 |
| EINECS: | 203-109-3 |
| Molecular Formula: | C16H14O2 |
| Molecular Weight: | 238.28 |
| InChI: | InChI=1/C16H14O2/c17-16(12-11-14-7-3-1-4-8-14)18-13-15-9-5-2-6-10-15/h1-12H,13H2/b12-11+ |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 91 C |
| Density: | 1.128 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4025-1.4045 |
| Water Solubility: | PRACTICALLY INSOLUBLE |
| Solubility: | Insoluble |
| Appearance: | White to pale yellow crystals |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29163900 |
| Flash Point: | 91 C |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | WHITE TO PALE-YELLOW, FUSED, CRYSTALLINE SOLID Crystals from 95% ethanol White crystals |
| Usage: | In artificial flavors, in perfumes, mainly as a fixative. |
| Safety Data | |
 |
|
